C33H48O4 — CID 57251654
3-[2,5-di(hexan-2-yloxy)phenyl]-1-(2-hexan-2-yloxyphenyl)prop-2-en-1-one (PubChem CID 57251654) has the molecular formula C33H48O4 and a molecular weight of 508.74 g/mol. Its IUPAC name is 3-[2,5-di(hexan-2-yloxy)phenyl]-1-(2-hexan-2-yloxyphenyl)prop-2-en-1-one.
| Compound Name | 3-[2,5-di(hexan-2-yloxy)phenyl]-1-(2-hexan-2-yloxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 57251654 |
| Molecular Formula | C33H48O4 |
| Molecular Weight | 508.74 g/mol |
| Exact Mass | 508.36 |
| IUPAC Name | 3-[2,5-di(hexan-2-yloxy)phenyl]-1-(2-hexan-2-yloxyphenyl)prop-2-en-1-one |
| SMILES | CCCCC(C)Oc1ccc(OC(C)CCCC)c(C=CC(=O)c2ccccc2OC(C)CCCC)c1 |
| InChI | InChI=1S/C33H48O4/c1-7-10-15-25(4)35-29-21-23-32(36-26(5)16-11-8-2)28(24-29)20-22-31(34)30-18-13-14-19-33(30)37-27(6)17-12-9-3/h13-14,18-27H,7-12,15-17H2,1-6H3 |
| InChIKey | QGLOUCDEUBJCGV-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.74 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|