2-octan-2-yloxybenzoyl chloride

C15H21ClO2 — CID 76502840

IUPAC2-octan-2-yloxybenzoyl chloride
SMILESCCCCCCC(C)Oc1ccccc1C(=O)Cl
InChIInChI=1S/C15H21ClO2/c1-3-4-5-6-9-12(2)18-14-11-8-7-10-13(14)15(16)17/h7-8,10-12H,3-6,9H2,1-2H3
InChIKeyNHIVRQJDXGTWCN-UHFFFAOYSA-N
MW268.78 g/mol
LogP4.80
Rot. Bonds8

About 2-octan-2-yloxybenzoyl chloride

2-octan-2-yloxybenzoyl chloride (PubChem CID 76502840) has the molecular formula C15H21ClO2 and a molecular weight of 268.78 g/mol. Its IUPAC name is 2-octan-2-yloxybenzoyl chloride.

Molecular Properties

Compound Name2-octan-2-yloxybenzoyl chloride
PubChem CID76502840
Molecular FormulaC15H21ClO2
Molecular Weight268.78 g/mol
Exact Mass268.12
IUPAC Name2-octan-2-yloxybenzoyl chloride
SMILESCCCCCCC(C)Oc1ccccc1C(=O)Cl
InChIInChI=1S/C15H21ClO2/c1-3-4-5-6-9-12(2)18-14-11-8-7-10-13(14)15(16)17/h7-8,10-12H,3-6,9H2,1-2H3
InChIKeyNHIVRQJDXGTWCN-UHFFFAOYSA-N
XLogP4.80
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds8
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500268.78
LogP ≤ 54.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-octan-2-yloxybenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-octan-2-yloxybenzoyl chloride?
The IUPAC name of 2-octan-2-yloxybenzoyl chloride (CID 76502840) is 2-octan-2-yloxybenzoyl chloride.
What is the SMILES notation for 2-octan-2-yloxybenzoyl chloride?
The canonical SMILES for 2-octan-2-yloxybenzoyl chloride is CCCCCCC(C)Oc1ccccc1C(=O)Cl.
What is the InChIKey of 2-octan-2-yloxybenzoyl chloride?
The InChIKey is NHIVRQJDXGTWCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21ClO2/c1-3-4-5-6-9-12(2)18-14-11-8-7-10-13(14)15(16)17/h7-8,10-12H,3-6,9H2,1-2H3.
What are the key properties of 2-octan-2-yloxybenzoyl chloride?
2-octan-2-yloxybenzoyl chloride has a molecular weight of 268.78 g/mol, XLogP of 4.80, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-octan-2-yloxybenzoyl chloride is sourced from PubChem (CID 76502840), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).