About 2-propan-2-yloxybenzoyl chloride
2-propan-2-yloxybenzoyl chloride (PubChem CID 15921914) has the molecular formula C10H11ClO2
and a molecular weight of 198.65 g/mol. Its IUPAC name is 2-propan-2-yloxybenzoyl chloride.
Molecular Properties
| Compound Name | 2-propan-2-yloxybenzoyl chloride |
| PubChem CID | 15921914 |
| Molecular Formula | C10H11ClO2 |
| Molecular Weight | 198.65 g/mol |
| Exact Mass | 198.04 |
| IUPAC Name | 2-propan-2-yloxybenzoyl chloride |
| SMILES | CC(C)Oc1ccccc1C(=O)Cl |
| InChI | InChI=1S/C10H11ClO2/c1-7(2)13-9-6-4-3-5-8(9)10(11)12/h3-7H,1-2H3 |
| InChIKey | CIYMDTDRZWFTTL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.65 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-propan-2-yloxybenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propan-2-yloxybenzoyl chloride?
The IUPAC name of 2-propan-2-yloxybenzoyl chloride (CID 15921914) is 2-propan-2-yloxybenzoyl chloride.
What is the SMILES notation for 2-propan-2-yloxybenzoyl chloride?
The canonical SMILES for 2-propan-2-yloxybenzoyl chloride is CC(C)Oc1ccccc1C(=O)Cl.
What is the InChIKey of 2-propan-2-yloxybenzoyl chloride?
The InChIKey is CIYMDTDRZWFTTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO2/c1-7(2)13-9-6-4-3-5-8(9)10(11)12/h3-7H,1-2H3.
What are the key properties of 2-propan-2-yloxybenzoyl chloride?
2-propan-2-yloxybenzoyl chloride has a molecular weight of 198.65 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxybenzoyl chloride is sourced from PubChem (CID 15921914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).