2-propan-2-yloxybenzoyl chloride

C10H11ClO2 — CID 15921914

IUPAC2-propan-2-yloxybenzoyl chloride
SMILESCC(C)Oc1ccccc1C(=O)Cl
InChIInChI=1S/C10H11ClO2/c1-7(2)13-9-6-4-3-5-8(9)10(11)12/h3-7H,1-2H3
InChIKeyCIYMDTDRZWFTTL-UHFFFAOYSA-N
MW198.65 g/mol
LogP2.85
Rot. Bonds3

About 2-propan-2-yloxybenzoyl chloride

2-propan-2-yloxybenzoyl chloride (PubChem CID 15921914) has the molecular formula C10H11ClO2 and a molecular weight of 198.65 g/mol. Its IUPAC name is 2-propan-2-yloxybenzoyl chloride.

Molecular Properties

Compound Name2-propan-2-yloxybenzoyl chloride
PubChem CID15921914
Molecular FormulaC10H11ClO2
Molecular Weight198.65 g/mol
Exact Mass198.04
IUPAC Name2-propan-2-yloxybenzoyl chloride
SMILESCC(C)Oc1ccccc1C(=O)Cl
InChIInChI=1S/C10H11ClO2/c1-7(2)13-9-6-4-3-5-8(9)10(11)12/h3-7H,1-2H3
InChIKeyCIYMDTDRZWFTTL-UHFFFAOYSA-N
XLogP2.85
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.65
LogP ≤ 52.85
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-propan-2-yloxybenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-propan-2-yloxybenzoyl chloride?
The IUPAC name of 2-propan-2-yloxybenzoyl chloride (CID 15921914) is 2-propan-2-yloxybenzoyl chloride.
What is the SMILES notation for 2-propan-2-yloxybenzoyl chloride?
The canonical SMILES for 2-propan-2-yloxybenzoyl chloride is CC(C)Oc1ccccc1C(=O)Cl.
What is the InChIKey of 2-propan-2-yloxybenzoyl chloride?
The InChIKey is CIYMDTDRZWFTTL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11ClO2/c1-7(2)13-9-6-4-3-5-8(9)10(11)12/h3-7H,1-2H3.
What are the key properties of 2-propan-2-yloxybenzoyl chloride?
2-propan-2-yloxybenzoyl chloride has a molecular weight of 198.65 g/mol, XLogP of 2.85, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propan-2-yloxybenzoyl chloride is sourced from PubChem (CID 15921914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).