C11H11Cl3O2 — CID 146008297
2,2,2-trichloro-1-(2-propan-2-yloxyphenyl)ethanone (PubChem CID 146008297) has the molecular formula C11H11Cl3O2 and a molecular weight of 281.57 g/mol. Its IUPAC name is 2,2,2-trichloro-1-(2-propan-2-yloxyphenyl)ethanone.
| Compound Name | 2,2,2-trichloro-1-(2-propan-2-yloxyphenyl)ethanone |
|---|---|
| PubChem CID | 146008297 |
| Molecular Formula | C11H11Cl3O2 |
| Molecular Weight | 281.57 g/mol |
| Exact Mass | 279.98 |
| IUPAC Name | 2,2,2-trichloro-1-(2-propan-2-yloxyphenyl)ethanone |
| SMILES | CC(C)Oc1ccccc1C(=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C11H11Cl3O2/c1-7(2)16-9-6-4-3-5-8(9)10(15)11(12,13)14/h3-7H,1-2H3 |
| InChIKey | XFZFAAUYRJZWQX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.57 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|