2-butan-2-yloxybenzoyl chloride

C11H13ClO2 — CID 134306055

IUPAC2-butan-2-yloxybenzoyl chloride
SMILESCCC(C)Oc1ccccc1C(=O)Cl
InChIInChI=1S/C11H13ClO2/c1-3-8(2)14-10-7-5-4-6-9(10)11(12)13/h4-8H,3H2,1-2H3
InChIKeyRKEBEBLALYIMGQ-UHFFFAOYSA-N
MW212.68 g/mol
LogP3.24
Rot. Bonds4

About 2-butan-2-yloxybenzoyl chloride

2-butan-2-yloxybenzoyl chloride (PubChem CID 134306055) has the molecular formula C11H13ClO2 and a molecular weight of 212.68 g/mol. Its IUPAC name is 2-butan-2-yloxybenzoyl chloride.

Molecular Properties

Compound Name2-butan-2-yloxybenzoyl chloride
PubChem CID134306055
Molecular FormulaC11H13ClO2
Molecular Weight212.68 g/mol
Exact Mass212.06
IUPAC Name2-butan-2-yloxybenzoyl chloride
SMILESCCC(C)Oc1ccccc1C(=O)Cl
InChIInChI=1S/C11H13ClO2/c1-3-8(2)14-10-7-5-4-6-9(10)11(12)13/h4-8H,3H2,1-2H3
InChIKeyRKEBEBLALYIMGQ-UHFFFAOYSA-N
XLogP3.24
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500212.68
LogP ≤ 53.24
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-butan-2-yloxybenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-butan-2-yloxybenzoyl chloride?
The IUPAC name of 2-butan-2-yloxybenzoyl chloride (CID 134306055) is 2-butan-2-yloxybenzoyl chloride.
What is the SMILES notation for 2-butan-2-yloxybenzoyl chloride?
The canonical SMILES for 2-butan-2-yloxybenzoyl chloride is CCC(C)Oc1ccccc1C(=O)Cl.
What is the InChIKey of 2-butan-2-yloxybenzoyl chloride?
The InChIKey is RKEBEBLALYIMGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO2/c1-3-8(2)14-10-7-5-4-6-9(10)11(12)13/h4-8H,3H2,1-2H3.
What are the key properties of 2-butan-2-yloxybenzoyl chloride?
2-butan-2-yloxybenzoyl chloride has a molecular weight of 212.68 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-butan-2-yloxybenzoyl chloride is sourced from PubChem (CID 134306055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).