2-(2-methylbutoxy)benzoyl chloride

C12H15ClO2 — CID 139627306

IUPAC2-(2-methylbutoxy)benzoyl chloride
SMILESCCC(C)COc1ccccc1C(=O)Cl
InChIInChI=1S/C12H15ClO2/c1-3-9(2)8-15-11-7-5-4-6-10(11)12(13)14/h4-7,9H,3,8H2,1-2H3
InChIKeySLOFZRGQJYPQFD-UHFFFAOYSA-N
MW226.70 g/mol
LogP3.49
Rot. Bonds5

About 2-(2-methylbutoxy)benzoyl chloride

2-(2-methylbutoxy)benzoyl chloride (PubChem CID 139627306) has the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. Its IUPAC name is 2-(2-methylbutoxy)benzoyl chloride.

Molecular Properties

Compound Name2-(2-methylbutoxy)benzoyl chloride
PubChem CID139627306
Molecular FormulaC12H15ClO2
Molecular Weight226.70 g/mol
Exact Mass226.08
IUPAC Name2-(2-methylbutoxy)benzoyl chloride
SMILESCCC(C)COc1ccccc1C(=O)Cl
InChIInChI=1S/C12H15ClO2/c1-3-9(2)8-15-11-7-5-4-6-10(11)12(13)14/h4-7,9H,3,8H2,1-2H3
InChIKeySLOFZRGQJYPQFD-UHFFFAOYSA-N
XLogP3.49
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500226.70
LogP ≤ 53.49
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 2-(2-methylbutoxy)benzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-methylbutoxy)benzoyl chloride?
The IUPAC name of 2-(2-methylbutoxy)benzoyl chloride (CID 139627306) is 2-(2-methylbutoxy)benzoyl chloride.
What is the SMILES notation for 2-(2-methylbutoxy)benzoyl chloride?
The canonical SMILES for 2-(2-methylbutoxy)benzoyl chloride is CCC(C)COc1ccccc1C(=O)Cl.
What is the InChIKey of 2-(2-methylbutoxy)benzoyl chloride?
The InChIKey is SLOFZRGQJYPQFD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClO2/c1-3-9(2)8-15-11-7-5-4-6-10(11)12(13)14/h4-7,9H,3,8H2,1-2H3.
What are the key properties of 2-(2-methylbutoxy)benzoyl chloride?
2-(2-methylbutoxy)benzoyl chloride has a molecular weight of 226.70 g/mol, XLogP of 3.49, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylbutoxy)benzoyl chloride is sourced from PubChem (CID 139627306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).