C36H46O6 — CID 175055883
bis(2-octan-2-yloxyphenyl) benzene-1,2-dicarboxylate (PubChem CID 175055883) has the molecular formula C36H46O6 and a molecular weight of 574.76 g/mol. Its IUPAC name is bis(2-octan-2-yloxyphenyl) benzene-1,2-dicarboxylate.
| Compound Name | bis(2-octan-2-yloxyphenyl) benzene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 175055883 |
| Molecular Formula | C36H46O6 |
| Molecular Weight | 574.76 g/mol |
| Exact Mass | 574.33 |
| IUPAC Name | bis(2-octan-2-yloxyphenyl) benzene-1,2-dicarboxylate |
| SMILES | CCCCCCC(C)Oc1ccccc1OC(=O)c1ccccc1C(=O)Oc1ccccc1OC(C)CCCCCC |
| InChI | InChI=1S/C36H46O6/c1-5-7-9-11-19-27(3)39-31-23-15-17-25-33(31)41-35(37)29-21-13-14-22-30(29)36(38)42-34-26-18-16-24-32(34)40-28(4)20-12-10-8-6-2/h13-18,21-28H,5-12,19-20H2,1-4H3 |
| InChIKey | SIPYMSKXDNRHTG-UHFFFAOYSA-N |
| XLogP | 9.60 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.76 |
| LogP ≤ 5 | 9.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|