C45H72O6 — CID 70289791
3-[2,5-di(hexan-3-yloxy)phenyl]-1-[2,3,6-tri(hexan-3-yloxy)phenyl]prop-2-en-1-one (PubChem CID 70289791) has the molecular formula C45H72O6 and a molecular weight of 709.07 g/mol. Its IUPAC name is 3-[2,5-di(hexan-3-yloxy)phenyl]-1-[2,3,6-tri(hexan-3-yloxy)phenyl]prop-2-en-1-one.
| Compound Name | 3-[2,5-di(hexan-3-yloxy)phenyl]-1-[2,3,6-tri(hexan-3-yloxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70289791 |
| Molecular Formula | C45H72O6 |
| Molecular Weight | 709.07 g/mol |
| Exact Mass | 708.53 |
| IUPAC Name | 3-[2,5-di(hexan-3-yloxy)phenyl]-1-[2,3,6-tri(hexan-3-yloxy)phenyl]prop-2-en-1-one |
| SMILES | CCCC(CC)Oc1ccc(OC(CC)CCC)c(C=CC(=O)c2c(OC(CC)CCC)ccc(OC(CC)CCC)c2OC(CC)CCC)c1 |
| InChI | InChI=1S/C45H72O6/c1-11-21-34(16-6)47-39-27-29-41(48-35(17-7)22-12-2)33(32-39)26-28-40(46)44-42(49-36(18-8)23-13-3)30-31-43(50-37(19-9)24-14-4)45(44)51-38(20-10)25-15-5/h26-32,34-38H,11-25H2,1-10H3 |
| InChIKey | KHPSNJSMEDNGEW-UHFFFAOYSA-N |
| XLogP | 13.37 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 28 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.07 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|