C14H20O5 — CID 113408873
4-(3,4,5-trimethoxyphenoxy)pentan-2-one (PubChem CID 113408873) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is 4-(3,4,5-trimethoxyphenoxy)pentan-2-one.
| Compound Name | 4-(3,4,5-trimethoxyphenoxy)pentan-2-one |
|---|---|
| PubChem CID | 113408873 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | 4-(3,4,5-trimethoxyphenoxy)pentan-2-one |
| SMILES | COc1cc(OC(C)CC(C)=O)cc(OC)c1OC |
| InChI | InChI=1S/C14H20O5/c1-9(15)6-10(2)19-11-7-12(16-3)14(18-5)13(8-11)17-4/h7-8,10H,6H2,1-5H3 |
| InChIKey | KGUOPDMKOLOTTC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |