C18H21ClO5 — CID 91335620
5-[1-(2-chlorophenoxy)propan-2-yloxy]-1,2,3-trimethoxybenzene (PubChem CID 91335620) has the molecular formula C18H21ClO5 and a molecular weight of 352.81 g/mol. Its IUPAC name is 5-[1-(2-chlorophenoxy)propan-2-yloxy]-1,2,3-trimethoxybenzene.
| Compound Name | 5-[1-(2-chlorophenoxy)propan-2-yloxy]-1,2,3-trimethoxybenzene |
|---|---|
| PubChem CID | 91335620 |
| Molecular Formula | C18H21ClO5 |
| Molecular Weight | 352.81 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | 5-[1-(2-chlorophenoxy)propan-2-yloxy]-1,2,3-trimethoxybenzene |
| SMILES | COc1cc(OC(C)COc2ccccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C18H21ClO5/c1-12(11-23-15-8-6-5-7-14(15)19)24-13-9-16(20-2)18(22-4)17(10-13)21-3/h5-10,12H,11H2,1-4H3 |
| InChIKey | WCPOLCCABPQJGL-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.81 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |