C13H19ClO3 — CID 118334255
1-(2-chlorophenoxy)-5-methylhexane-2,3-diol (PubChem CID 118334255) has the molecular formula C13H19ClO3 and a molecular weight of 258.74 g/mol. Its IUPAC name is 1-(2-chlorophenoxy)-5-methylhexane-2,3-diol.
| Compound Name | 1-(2-chlorophenoxy)-5-methylhexane-2,3-diol |
|---|---|
| PubChem CID | 118334255 |
| Molecular Formula | C13H19ClO3 |
| Molecular Weight | 258.74 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | 1-(2-chlorophenoxy)-5-methylhexane-2,3-diol |
| SMILES | CC(C)CC(O)C(O)COc1ccccc1Cl |
| InChI | InChI=1S/C13H19ClO3/c1-9(2)7-11(15)12(16)8-17-13-6-4-3-5-10(13)14/h3-6,9,11-12,15-16H,7-8H2,1-2H3 |
| InChIKey | HLRHEAAADONKMX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.74 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |