C9H12ClNO3 — CID 156554315
2-amino-3-(2-chlorophenoxy)propane-1,1-diol (PubChem CID 156554315) has the molecular formula C9H12ClNO3 and a molecular weight of 217.65 g/mol. Its IUPAC name is 2-amino-3-(2-chlorophenoxy)propane-1,1-diol.
| Compound Name | 2-amino-3-(2-chlorophenoxy)propane-1,1-diol |
|---|---|
| PubChem CID | 156554315 |
| Molecular Formula | C9H12ClNO3 |
| Molecular Weight | 217.65 g/mol |
| Exact Mass | 217.05 |
| IUPAC Name | 2-amino-3-(2-chlorophenoxy)propane-1,1-diol |
| SMILES | NC(COc1ccccc1Cl)C(O)O |
| InChI | InChI=1S/C9H12ClNO3/c10-6-3-1-2-4-8(6)14-5-7(11)9(12)13/h1-4,7,9,12-13H,5,11H2 |
| InChIKey | SYIUIRSGTRSLGD-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.65 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|