C12H18ClNO3S — CID 65012785
2-[(2-chlorophenoxy)methyl]-3-methylbutane-1-sulfonamide (PubChem CID 65012785) has the molecular formula C12H18ClNO3S and a molecular weight of 291.80 g/mol. Its IUPAC name is 2-[(2-chlorophenoxy)methyl]-3-methylbutane-1-sulfonamide.
| Compound Name | 2-[(2-chlorophenoxy)methyl]-3-methylbutane-1-sulfonamide |
|---|---|
| PubChem CID | 65012785 |
| Molecular Formula | C12H18ClNO3S |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 2-[(2-chlorophenoxy)methyl]-3-methylbutane-1-sulfonamide |
| SMILES | CC(C)C(COc1ccccc1Cl)CS(N)(=O)=O |
| InChI | InChI=1S/C12H18ClNO3S/c1-9(2)10(8-18(14,15)16)7-17-12-6-4-3-5-11(12)13/h3-6,9-10H,7-8H2,1-2H3,(H2,14,15,16) |
| InChIKey | SQSXYTXZRAXMQH-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |