C16H17ClO4 — CID 2283961
2-[2-(2-chlorophenoxy)ethoxy]-1,3-dimethoxybenzene (PubChem CID 2283961) has the molecular formula C16H17ClO4 and a molecular weight of 308.76 g/mol. Its IUPAC name is 2-[2-(2-chlorophenoxy)ethoxy]-1,3-dimethoxybenzene.
| Compound Name | 2-[2-(2-chlorophenoxy)ethoxy]-1,3-dimethoxybenzene |
|---|---|
| PubChem CID | 2283961 |
| Molecular Formula | C16H17ClO4 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-[2-(2-chlorophenoxy)ethoxy]-1,3-dimethoxybenzene |
| SMILES | COc1cccc(OC)c1OCCOc1ccccc1Cl |
| InChI | InChI=1S/C16H17ClO4/c1-18-14-8-5-9-15(19-2)16(14)21-11-10-20-13-7-4-3-6-12(13)17/h3-9H,10-11H2,1-2H3 |
| InChIKey | MBUDLGABMBCDAT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|