C21H24O7 — CID 54466705
1,3-bis(2,3,5-trimethoxyphenyl)prop-2-en-1-one (PubChem CID 54466705) has the molecular formula C21H24O7 and a molecular weight of 388.42 g/mol. Its IUPAC name is 1,3-bis(2,3,5-trimethoxyphenyl)prop-2-en-1-one.
| Compound Name | 1,3-bis(2,3,5-trimethoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 54466705 |
| Molecular Formula | C21H24O7 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.15 |
| IUPAC Name | 1,3-bis(2,3,5-trimethoxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(C=CC(=O)c2cc(OC)cc(OC)c2OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C21H24O7/c1-23-14-9-13(20(27-5)18(11-14)25-3)7-8-17(22)16-10-15(24-2)12-19(26-4)21(16)28-6/h7-12H,1-6H3 |
| InChIKey | XFJVUOKQYFJVHD-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|