C17H15BrO4 — CID 78163871
3-(5-bromo-2,3-dimethoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one (PubChem CID 78163871) has the molecular formula C17H15BrO4 and a molecular weight of 363.21 g/mol. Its IUPAC name is 3-(5-bromo-2,3-dimethoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(5-bromo-2,3-dimethoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 78163871 |
| Molecular Formula | C17H15BrO4 |
| Molecular Weight | 363.21 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | 3-(5-bromo-2,3-dimethoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(Br)cc(C=CC(=O)c2ccccc2O)c1OC |
| InChI | InChI=1S/C17H15BrO4/c1-21-16-10-12(18)9-11(17(16)22-2)7-8-15(20)13-5-3-4-6-14(13)19/h3-10,19H,1-2H3 |
| InChIKey | CEYRFGWGPWCINV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.21 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|