C20H21FO4 — CID 175493096
(E)-3-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one (PubChem CID 175493096) has the molecular formula C20H21FO4 and a molecular weight of 344.38 g/mol. Its IUPAC name is (E)-3-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-3-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 175493096 |
| Molecular Formula | C20H21FO4 |
| Molecular Weight | 344.38 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | (E)-3-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one |
| SMILES | COc1cc(/C=C/C(=O)c2ccccc2O)c(F)c(OC)c1C(C)C |
| InChI | InChI=1S/C20H21FO4/c1-12(2)18-17(24-3)11-13(19(21)20(18)25-4)9-10-16(23)14-7-5-6-8-15(14)22/h5-12,22H,1-4H3/b10-9+ |
| InChIKey | BNICEVKWGVAHOT-MDZDMXLPSA-N |
| XLogP | 4.57 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.38 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|