C18H16Cl2O5 — CID 137379029
3-(2,6-dichloro-3,4,5-trimethoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one (PubChem CID 137379029) has the molecular formula C18H16Cl2O5 and a molecular weight of 383.23 g/mol. Its IUPAC name is 3-(2,6-dichloro-3,4,5-trimethoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one.
| Compound Name | 3-(2,6-dichloro-3,4,5-trimethoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 137379029 |
| Molecular Formula | C18H16Cl2O5 |
| Molecular Weight | 383.23 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | 3-(2,6-dichloro-3,4,5-trimethoxyphenyl)-1-(2-hydroxyphenyl)prop-2-en-1-one |
| SMILES | COc1c(Cl)c(C=CC(=O)c2ccccc2O)c(Cl)c(OC)c1OC |
| InChI | InChI=1S/C18H16Cl2O5/c1-23-16-14(19)11(15(20)17(24-2)18(16)25-3)8-9-13(22)10-6-4-5-7-12(10)21/h4-9,21H,1-3H3 |
| InChIKey | DCXDQSZCUYKQQS-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.23 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|