C16H13BrO4 — CID 6447965
(E)-1-(5-bromo-2,4-dihydroxyphenyl)-3-(2-methoxyphenyl)prop-2-en-1-one (PubChem CID 6447965) has the molecular formula C16H13BrO4 and a molecular weight of 349.18 g/mol. Its IUPAC name is (E)-1-(5-bromo-2,4-dihydroxyphenyl)-3-(2-methoxyphenyl)prop-2-en-1-one.
| Compound Name | (E)-1-(5-bromo-2,4-dihydroxyphenyl)-3-(2-methoxyphenyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 6447965 |
| Molecular Formula | C16H13BrO4 |
| Molecular Weight | 349.18 g/mol |
| Exact Mass | 348.00 |
| IUPAC Name | (E)-1-(5-bromo-2,4-dihydroxyphenyl)-3-(2-methoxyphenyl)prop-2-en-1-one |
| SMILES | COc1ccccc1/C=C/C(=O)c1cc(Br)c(O)cc1O |
| InChI | InChI=1S/C16H13BrO4/c1-21-16-5-3-2-4-10(16)6-7-13(18)11-8-12(17)15(20)9-14(11)19/h2-9,19-20H,1H3/b7-6+ |
| InChIKey | NKFZQIXNOYVXMM-VOTSOKGWSA-N |
| XLogP | 3.77 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.18 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|