C17H13BrO4 — CID 71966517
5-bromo-2-hydroxy-3-[3-(2-methoxyphenyl)prop-2-enoyl]cyclohepta-2,4,6-trien-1-one (PubChem CID 71966517) has the molecular formula C17H13BrO4 and a molecular weight of 361.19 g/mol. Its IUPAC name is 5-bromo-2-hydroxy-3-[3-(2-methoxyphenyl)prop-2-enoyl]cyclohepta-2,4,6-trien-1-one.
| Compound Name | 5-bromo-2-hydroxy-3-[3-(2-methoxyphenyl)prop-2-enoyl]cyclohepta-2,4,6-trien-1-one |
|---|---|
| PubChem CID | 71966517 |
| Molecular Formula | C17H13BrO4 |
| Molecular Weight | 361.19 g/mol |
| Exact Mass | 360.00 |
| IUPAC Name | 5-bromo-2-hydroxy-3-[3-(2-methoxyphenyl)prop-2-enoyl]cyclohepta-2,4,6-trien-1-one |
| SMILES | COc1ccccc1C=CC(=O)c1cc(Br)ccc(=O)c1O |
| InChI | InChI=1S/C17H13BrO4/c1-22-16-5-3-2-4-11(16)6-8-14(19)13-10-12(18)7-9-15(20)17(13)21/h2-10H,1H3,(H,20,21) |
| InChIKey | DPJGKQFFWYJGRO-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.19 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|