C29H40O4 — CID 70019323
1-[2,3-bis(2-methylpropoxy)phenyl]-3-[5-ethyl-2-(2-methylpropoxy)phenyl]prop-2-en-1-one (PubChem CID 70019323) has the molecular formula C29H40O4 and a molecular weight of 452.64 g/mol. Its IUPAC name is 1-[2,3-bis(2-methylpropoxy)phenyl]-3-[5-ethyl-2-(2-methylpropoxy)phenyl]prop-2-en-1-one.
| Compound Name | 1-[2,3-bis(2-methylpropoxy)phenyl]-3-[5-ethyl-2-(2-methylpropoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70019323 |
| Molecular Formula | C29H40O4 |
| Molecular Weight | 452.64 g/mol |
| Exact Mass | 452.29 |
| IUPAC Name | 1-[2,3-bis(2-methylpropoxy)phenyl]-3-[5-ethyl-2-(2-methylpropoxy)phenyl]prop-2-en-1-one |
| SMILES | CCc1ccc(OCC(C)C)c(C=CC(=O)c2cccc(OCC(C)C)c2OCC(C)C)c1 |
| InChI | InChI=1S/C29H40O4/c1-8-23-12-15-27(31-17-20(2)3)24(16-23)13-14-26(30)25-10-9-11-28(32-18-21(4)5)29(25)33-19-22(6)7/h9-16,20-22H,8,17-19H2,1-7H3 |
| InChIKey | FDKMZJIDXXWEJM-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.64 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|