C33H48O5 — CID 70016346
(E)-3-[5-ethyl-2-(2-methylpropoxy)phenyl]-1-[2,3,6-tris(2-methylpropoxy)phenyl]prop-2-en-1-one (PubChem CID 70016346) has the molecular formula C33H48O5 and a molecular weight of 524.74 g/mol. Its IUPAC name is (E)-3-[5-ethyl-2-(2-methylpropoxy)phenyl]-1-[2,3,6-tris(2-methylpropoxy)phenyl]prop-2-en-1-one.
| Compound Name | (E)-3-[5-ethyl-2-(2-methylpropoxy)phenyl]-1-[2,3,6-tris(2-methylpropoxy)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 70016346 |
| Molecular Formula | C33H48O5 |
| Molecular Weight | 524.74 g/mol |
| Exact Mass | 524.35 |
| IUPAC Name | (E)-3-[5-ethyl-2-(2-methylpropoxy)phenyl]-1-[2,3,6-tris(2-methylpropoxy)phenyl]prop-2-en-1-one |
| SMILES | CCc1ccc(OCC(C)C)c(/C=C/C(=O)c2c(OCC(C)C)ccc(OCC(C)C)c2OCC(C)C)c1 |
| InChI | InChI=1S/C33H48O5/c1-10-26-11-14-29(35-18-22(2)3)27(17-26)12-13-28(34)32-30(36-19-23(4)5)15-16-31(37-20-24(6)7)33(32)38-21-25(8)9/h11-17,22-25H,10,18-21H2,1-9H3/b13-12+ |
| InChIKey | KMHHYWPBDQUJMA-OUKQBFOZSA-N |
| XLogP | 8.28 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.74 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|