(E)-3-(5-chloro-2-propan-2-yloxyphenyl)prop-2-enoyl chloride

C12H12Cl2O2 — CID 102538031

IUPAC(E)-3-(5-chloro-2-propan-2-yloxyphenyl)prop-2-enoyl chloride
SMILESCC(C)Oc1ccc(Cl)cc1/C=C/C(=O)Cl
InChIInChI=1S/C12H12Cl2O2/c1-8(2)16-11-5-4-10(13)7-9(11)3-6-12(14)15/h3-8H,1-2H3/b6-3+
InChIKeyARVRNUZNGDPAIZ-ZZXKWVIFSA-N
MW259.13 g/mol
LogP3.91
Rot. Bonds4

About (E)-3-(5-chloro-2-propan-2-yloxyphenyl)prop-2-enoyl chloride

(E)-3-(5-chloro-2-propan-2-yloxyphenyl)prop-2-enoyl chloride (PubChem CID 102538031) has the molecular formula C12H12Cl2O2 and a molecular weight of 259.13 g/mol. Its IUPAC name is (E)-3-(5-chloro-2-propan-2-yloxyphenyl)prop-2-enoyl chloride.

Molecular Properties

Compound Name(E)-3-(5-chloro-2-propan-2-yloxyphenyl)prop-2-enoyl chloride
PubChem CID102538031
Molecular FormulaC12H12Cl2O2
Molecular Weight259.13 g/mol
Exact Mass258.02
IUPAC Name(E)-3-(5-chloro-2-propan-2-yloxyphenyl)prop-2-enoyl chloride
SMILESCC(C)Oc1ccc(Cl)cc1/C=C/C(=O)Cl
InChIInChI=1S/C12H12Cl2O2/c1-8(2)16-11-5-4-10(13)7-9(11)3-6-12(14)15/h3-8H,1-2H3/b6-3+
InChIKeyARVRNUZNGDPAIZ-ZZXKWVIFSA-N
XLogP3.91
TPSA26.30 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500259.13
LogP ≤ 53.91
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (E)-3-(5-chloro-2-propan-2-yloxyphenyl)prop-2-enoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (E)-3-(5-chloro-2-propan-2-yloxyphenyl)prop-2-enoyl chloride?
The IUPAC name of (E)-3-(5-chloro-2-propan-2-yloxyphenyl)prop-2-enoyl chloride (CID 102538031) is (E)-3-(5-chloro-2-propan-2-yloxyphenyl)prop-2-enoyl chloride.
What is the SMILES notation for (E)-3-(5-chloro-2-propan-2-yloxyphenyl)prop-2-enoyl chloride?
The canonical SMILES for (E)-3-(5-chloro-2-propan-2-yloxyphenyl)prop-2-enoyl chloride is CC(C)Oc1ccc(Cl)cc1/C=C/C(=O)Cl.
What is the InChIKey of (E)-3-(5-chloro-2-propan-2-yloxyphenyl)prop-2-enoyl chloride?
The InChIKey is ARVRNUZNGDPAIZ-ZZXKWVIFSA-N. The full InChI is InChI=1S/C12H12Cl2O2/c1-8(2)16-11-5-4-10(13)7-9(11)3-6-12(14)15/h3-8H,1-2H3/b6-3+.
What are the key properties of (E)-3-(5-chloro-2-propan-2-yloxyphenyl)prop-2-enoyl chloride?
(E)-3-(5-chloro-2-propan-2-yloxyphenyl)prop-2-enoyl chloride has a molecular weight of 259.13 g/mol, XLogP of 3.91, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-(5-chloro-2-propan-2-yloxyphenyl)prop-2-enoyl chloride is sourced from PubChem (CID 102538031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).