C16H21ClO4 — CID 76905044
3-[5-chloro-2-[2-(3-methylbutoxy)ethoxy]phenyl]prop-2-enoic acid (PubChem CID 76905044) has the molecular formula C16H21ClO4 and a molecular weight of 312.79 g/mol. Its IUPAC name is 3-[5-chloro-2-[2-(3-methylbutoxy)ethoxy]phenyl]prop-2-enoic acid.
| Compound Name | 3-[5-chloro-2-[2-(3-methylbutoxy)ethoxy]phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 76905044 |
| Molecular Formula | C16H21ClO4 |
| Molecular Weight | 312.79 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 3-[5-chloro-2-[2-(3-methylbutoxy)ethoxy]phenyl]prop-2-enoic acid |
| SMILES | CC(C)CCOCCOc1ccc(Cl)cc1C=CC(=O)O |
| InChI | InChI=1S/C16H21ClO4/c1-12(2)7-8-20-9-10-21-15-5-4-14(17)11-13(15)3-6-16(18)19/h3-6,11-12H,7-10H2,1-2H3,(H,18,19) |
| InChIKey | OXXSPWDUDDVUSN-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.79 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|