C14H17Cl2NO4Ru — CID 59273360
dichloro-[[5-[(2-ethoxy-2-oxoacetyl)amino]-2-propan-2-yloxyphenyl]methylidene]ruthenium (PubChem CID 59273360) has the molecular formula C14H17Cl2NO4Ru and a molecular weight of 435.27 g/mol. Its IUPAC name is dichloro-[[5-[(2-ethoxy-2-oxoacetyl)amino]-2-propan-2-yloxyphenyl]methylidene]ruthenium.
| Compound Name | dichloro-[[5-[(2-ethoxy-2-oxoacetyl)amino]-2-propan-2-yloxyphenyl]methylidene]ruthenium |
|---|---|
| PubChem CID | 59273360 |
| Molecular Formula | C14H17Cl2NO4Ru |
| Molecular Weight | 435.27 g/mol |
| Exact Mass | 434.96 |
| IUPAC Name | dichloro-[[5-[(2-ethoxy-2-oxoacetyl)amino]-2-propan-2-yloxyphenyl]methylidene]ruthenium |
| SMILES | CCOC(=O)C(=O)Nc1ccc(OC(C)C)c(C=[Ru](Cl)Cl)c1 |
| InChI | InChI=1S/C14H17NO4.2ClH.Ru/c1-5-18-14(17)13(16)15-11-6-7-12(10(4)8-11)19-9(2)3;;;/h4,6-9H,5H2,1-3H3,(H,15,16);2*1H;/q;;;+2/p-2 |
| InChIKey | FQLPTVRBYCIKIL-UHFFFAOYSA-L |
| XLogP | 3.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.27 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|