C19H34N2O+2 — CID 102326558
(3-ethenyl-4-propan-2-yloxyphenyl)methyl-dimethyl-[2-(trimethylazaniumyl)ethyl]azanium (PubChem CID 102326558) has the molecular formula C19H34N2O+2 and a molecular weight of 306.49 g/mol. Its IUPAC name is (3-ethenyl-4-propan-2-yloxyphenyl)methyl-dimethyl-[2-(trimethylazaniumyl)ethyl]azanium.
| Compound Name | (3-ethenyl-4-propan-2-yloxyphenyl)methyl-dimethyl-[2-(trimethylazaniumyl)ethyl]azanium |
|---|---|
| PubChem CID | 102326558 |
| Molecular Formula | C19H34N2O+2 |
| Molecular Weight | 306.49 g/mol |
| Exact Mass | 306.27 |
| IUPAC Name | (3-ethenyl-4-propan-2-yloxyphenyl)methyl-dimethyl-[2-(trimethylazaniumyl)ethyl]azanium |
| SMILES | C=Cc1cc(C[N+](C)(C)CC[N+](C)(C)C)ccc1OC(C)C |
| InChI | InChI=1S/C19H34N2O/c1-9-18-14-17(10-11-19(18)22-16(2)3)15-21(7,8)13-12-20(4,5)6/h9-11,14,16H,1,12-13,15H2,2-8H3/q+2 |
| InChIKey | ISBQRLLPUSSFOX-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|