C32H55ClOPRu — CID 59215317
butane;chloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium (PubChem CID 59215317) has the molecular formula C32H55ClOPRu and a molecular weight of 623.29 g/mol. Its IUPAC name is butane;chloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium.
| Compound Name | butane;chloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium |
|---|---|
| PubChem CID | 59215317 |
| Molecular Formula | C32H55ClOPRu |
| Molecular Weight | 623.29 g/mol |
| Exact Mass | 623.27 |
| IUPAC Name | butane;chloro-[(2-propan-2-yloxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium |
| SMILES | C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.CC(C)Oc1ccccc1/C=[Ru]/Cl.[CH2-]CCC |
| InChI | InChI=1S/C18H33P.C10H12O.C4H9.ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-8(2)11-10-7-5-4-6-9(10)3;1-3-4-2;;/h16-18H,1-15H2;3-8H,1-2H3;1,3-4H2,2H3;1H;/q;;-1;;+1 |
| InChIKey | VAKBYYIHJNYVEP-UHFFFAOYSA-N |
| XLogP | 10.68 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.29 |
| LogP ≤ 5 | 10.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|