C48H63N3O7PRu+2 — CID 140711051
2-[[N-[(2-hydroxy-5-nitrophenyl)methyl]anilino]methyl]-4-nitrophenol;(2-propan-2-yloxyphenyl)methylideneruthenium(1+);tricyclohexylphosphanium (PubChem CID 140711051) has the molecular formula C48H63N3O7PRu+2 and a molecular weight of 926.09 g/mol. Its IUPAC name is 2-[[N-[(2-hydroxy-5-nitrophenyl)methyl]anilino]methyl]-4-nitrophenol;(2-propan-2-yloxyphenyl)methylideneruthenium(1+);tricyclohexylphosphanium.
| Compound Name | 2-[[N-[(2-hydroxy-5-nitrophenyl)methyl]anilino]methyl]-4-nitrophenol;(2-propan-2-yloxyphenyl)methylideneruthenium(1+);tricyclohexylphosphanium |
|---|---|
| PubChem CID | 140711051 |
| Molecular Formula | C48H63N3O7PRu+2 |
| Molecular Weight | 926.09 g/mol |
| Exact Mass | 926.34 |
| IUPAC Name | 2-[[N-[(2-hydroxy-5-nitrophenyl)methyl]anilino]methyl]-4-nitrophenol;(2-propan-2-yloxyphenyl)methylideneruthenium(1+);tricyclohexylphosphanium |
| SMILES | C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.CC(C)Oc1ccccc1C=[Ru+].O=[N+]([O-])c1ccc(O)c(CN(Cc2cc([N+](=O)[O-])ccc2O)c2ccccc2)c1 |
| InChI | InChI=1S/C20H17N3O6.C18H33P.C10H12O.Ru/c24-19-8-6-17(22(26)27)10-14(19)12-21(16-4-2-1-3-5-16)13-15-11-18(23(28)29)7-9-20(15)25;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-8(2)11-10-7-5-4-6-9(10)3;/h1-11,24-25H,12-13H2;16-18H,1-15H2;3-8H,1-2H3;/q;;;+1/p+1 |
| InChIKey | QSXJLGKSOFNHNN-UHFFFAOYSA-O |
| XLogP | 12.49 |
| TPSA | 139.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 926.09 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|