C14H21ClN2O5 — CID 119911556
3-[methyl-[(5-nitro-2-propan-2-yloxyphenyl)methyl]amino]propanoic acid;hydrochloride (PubChem CID 119911556) has the molecular formula C14H21ClN2O5 and a molecular weight of 332.78 g/mol. Its IUPAC name is 3-[methyl-[(5-nitro-2-propan-2-yloxyphenyl)methyl]amino]propanoic acid;hydrochloride.
| Compound Name | 3-[methyl-[(5-nitro-2-propan-2-yloxyphenyl)methyl]amino]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 119911556 |
| Molecular Formula | C14H21ClN2O5 |
| Molecular Weight | 332.78 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 3-[methyl-[(5-nitro-2-propan-2-yloxyphenyl)methyl]amino]propanoic acid;hydrochloride |
| SMILES | CC(C)Oc1ccc([N+](=O)[O-])cc1CN(C)CCC(=O)O.Cl |
| InChI | InChI=1S/C14H20N2O5.ClH/c1-10(2)21-13-5-4-12(16(19)20)8-11(13)9-15(3)7-6-14(17)18;/h4-5,8,10H,6-7,9H2,1-3H3,(H,17,18);1H |
| InChIKey | AMLZSDPAIOBELW-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.78 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|