C11H14N4O5 — CID 43472575
2-[2-(aminomethyl)-4-nitrophenoxy]-N-carbamoylpropanamide (PubChem CID 43472575) has the molecular formula C11H14N4O5 and a molecular weight of 282.26 g/mol. Its IUPAC name is 2-[2-(aminomethyl)-4-nitrophenoxy]-N-carbamoylpropanamide.
| Compound Name | 2-[2-(aminomethyl)-4-nitrophenoxy]-N-carbamoylpropanamide |
|---|---|
| PubChem CID | 43472575 |
| Molecular Formula | C11H14N4O5 |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 2-[2-(aminomethyl)-4-nitrophenoxy]-N-carbamoylpropanamide |
| SMILES | CC(Oc1ccc([N+](=O)[O-])cc1CN)C(=O)NC(N)=O |
| InChI | InChI=1S/C11H14N4O5/c1-6(10(16)14-11(13)17)20-9-3-2-8(15(18)19)4-7(9)5-12/h2-4,6H,5,12H2,1H3,(H3,13,14,16,17) |
| InChIKey | LKYNBSMYWDBUGT-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 150.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|