C14H17N3O4 — CID 60887470
2-[2-(methylaminomethyl)-4-nitrophenoxy]-N-prop-2-ynylpropanamide (PubChem CID 60887470) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-[2-(methylaminomethyl)-4-nitrophenoxy]-N-prop-2-ynylpropanamide.
| Compound Name | 2-[2-(methylaminomethyl)-4-nitrophenoxy]-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 60887470 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-[2-(methylaminomethyl)-4-nitrophenoxy]-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)C(C)Oc1ccc([N+](=O)[O-])cc1CNC |
| InChI | InChI=1S/C14H17N3O4/c1-4-7-16-14(18)10(2)21-13-6-5-12(17(19)20)8-11(13)9-15-3/h1,5-6,8,10,15H,7,9H2,2-3H3,(H,16,18) |
| InChIKey | FLGAJEDIBZZRIO-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|