C13H11N3O4 — CID 47449675
2-(4-cyano-2-nitrophenoxy)-N-prop-2-ynylpropanamide (PubChem CID 47449675) has the molecular formula C13H11N3O4 and a molecular weight of 273.25 g/mol. Its IUPAC name is 2-(4-cyano-2-nitrophenoxy)-N-prop-2-ynylpropanamide.
| Compound Name | 2-(4-cyano-2-nitrophenoxy)-N-prop-2-ynylpropanamide |
|---|---|
| PubChem CID | 47449675 |
| Molecular Formula | C13H11N3O4 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-(4-cyano-2-nitrophenoxy)-N-prop-2-ynylpropanamide |
| SMILES | C#CCNC(=O)C(C)Oc1ccc(C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H11N3O4/c1-3-6-15-13(17)9(2)20-12-5-4-10(8-14)7-11(12)16(18)19/h1,4-5,7,9H,6H2,2H3,(H,15,17) |
| InChIKey | GIQSYKQOMFSVPV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 105.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|