C12H12N4O5 — CID 115595440
2-(4-cyano-2-nitrophenoxy)-N-(methylcarbamoyl)propanamide (PubChem CID 115595440) has the molecular formula C12H12N4O5 and a molecular weight of 292.25 g/mol. Its IUPAC name is 2-(4-cyano-2-nitrophenoxy)-N-(methylcarbamoyl)propanamide.
| Compound Name | 2-(4-cyano-2-nitrophenoxy)-N-(methylcarbamoyl)propanamide |
|---|---|
| PubChem CID | 115595440 |
| Molecular Formula | C12H12N4O5 |
| Molecular Weight | 292.25 g/mol |
| Exact Mass | 292.08 |
| IUPAC Name | 2-(4-cyano-2-nitrophenoxy)-N-(methylcarbamoyl)propanamide |
| SMILES | CNC(=O)NC(=O)C(C)Oc1ccc(C#N)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12N4O5/c1-7(11(17)15-12(18)14-2)21-10-4-3-8(6-13)5-9(10)16(19)20/h3-5,7H,1-2H3,(H2,14,15,17,18) |
| InChIKey | XBRHDXWYXIYYPN-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 134.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.25 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|