About carbanide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium
carbanide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium (PubChem CID 159473860) has the molecular formula C26H43ClOPRu
and a molecular weight of 539.13 g/mol. Its IUPAC name is carbanide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium.
Molecular Properties
| Compound Name | carbanide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium |
| PubChem CID | 159473860 |
| Molecular Formula | C26H43ClOPRu |
| Molecular Weight | 539.13 g/mol |
| Exact Mass | 539.18 |
| IUPAC Name | carbanide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium |
| SMILES | C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.Oc1ccccc1/C=[Ru]\Cl.[CH3-] |
| InChI | InChI=1S/C18H33P.C7H6O.CH3.ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-6-4-2-3-5-7(6)8;;;/h16-18H,1-15H2;1-5,8H;1H3;1H;/q;;-1;;+1 |
| InChIKey | OGFHRAZGJQVPLD-UHFFFAOYSA-N |
| XLogP | 8.43 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 539.13 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze carbanide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbanide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium?
The IUPAC name of carbanide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium (CID 159473860) is carbanide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium.
What is the SMILES notation for carbanide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium?
The canonical SMILES for carbanide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium is C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.Oc1ccccc1/C=[Ru]\Cl.[CH3-].
What is the InChIKey of carbanide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium?
The InChIKey is OGFHRAZGJQVPLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H33P.C7H6O.CH3.ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-6-4-2-3-5-7(6)8;;;/h16-18H,1-15H2;1-5,8H;1H3;1H;/q;;-1;;+1.
What are the key properties of carbanide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium?
carbanide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium has a molecular weight of 539.13 g/mol, XLogP of 8.43, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbanide;chloro-[(2-hydroxyphenyl)methylidene]ruthenium;tricyclohexylphosphanium is sourced from PubChem (CID 159473860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).