C26H42Cl2PRu+ — CID 87671530
dichloro(2-phenylethylidene)ruthenium;tricyclohexylphosphanium (PubChem CID 87671530) has the molecular formula C26H42Cl2PRu+ and a molecular weight of 557.57 g/mol. Its IUPAC name is dichloro(2-phenylethylidene)ruthenium;tricyclohexylphosphanium.
| Compound Name | dichloro(2-phenylethylidene)ruthenium;tricyclohexylphosphanium |
|---|---|
| PubChem CID | 87671530 |
| Molecular Formula | C26H42Cl2PRu+ |
| Molecular Weight | 557.57 g/mol |
| Exact Mass | 557.14 |
| IUPAC Name | dichloro(2-phenylethylidene)ruthenium;tricyclohexylphosphanium |
| SMILES | C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.Cl[Ru](Cl)=CCc1ccccc1 |
| InChI | InChI=1S/C18H33P.C8H8.2ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-2-8-6-4-3-5-7-8;;;/h16-18H,1-15H2;1,3-7H,2H2;2*1H;/q;;;;+2/p-1 |
| InChIKey | ZCBDZTFWJGPPIE-UHFFFAOYSA-M |
| XLogP | 9.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.57 |
| LogP ≤ 5 | 9.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|