C45H82Cl2N2P2Ru+4 — CID 20682587
benzylidene(dichloro)ruthenium;bis(dicyclohexyl-(1,1-dimethylpiperidin-1-ium-4-yl)phosphanium) (PubChem CID 20682587) has the molecular formula C45H82Cl2N2P2Ru+4 and a molecular weight of 885.09 g/mol. Its IUPAC name is benzylidene(dichloro)ruthenium;bis(dicyclohexyl-(1,1-dimethylpiperidin-1-ium-4-yl)phosphanium).
| Compound Name | benzylidene(dichloro)ruthenium;bis(dicyclohexyl-(1,1-dimethylpiperidin-1-ium-4-yl)phosphanium) |
|---|---|
| PubChem CID | 20682587 |
| Molecular Formula | C45H82Cl2N2P2Ru+4 |
| Molecular Weight | 885.09 g/mol |
| Exact Mass | 884.44 |
| IUPAC Name | benzylidene(dichloro)ruthenium;bis(dicyclohexyl-(1,1-dimethylpiperidin-1-ium-4-yl)phosphanium) |
| SMILES | C[N+]1(C)CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.C[N+]1(C)CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.Cl[Ru](Cl)=Cc1ccccc1 |
| InChI | InChI=1S/2C19H37NP.C7H6.2ClH.Ru/c2*1-20(2)15-13-19(14-16-20)21(17-9-5-3-6-10-17)18-11-7-4-8-12-18;1-7-5-3-2-4-6-7;;;/h2*17-19H,3-16H2,1-2H3;1-6H;2*1H;/q2*+1;;;;+2 |
| InChIKey | LQNXHEZEASWRAM-UHFFFAOYSA-N |
| XLogP | 12.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 885.09 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|