C34H59Cl2N2PRu — CID 58905757
benzylidene(dichloro)ruthenium;1,3-dipropylimidazolidin-2-ide;tricyclohexylphosphanium (PubChem CID 58905757) has the molecular formula C34H59Cl2N2PRu and a molecular weight of 698.81 g/mol. Its IUPAC name is benzylidene(dichloro)ruthenium;1,3-dipropylimidazolidin-2-ide;tricyclohexylphosphanium.
| Compound Name | benzylidene(dichloro)ruthenium;1,3-dipropylimidazolidin-2-ide;tricyclohexylphosphanium |
|---|---|
| PubChem CID | 58905757 |
| Molecular Formula | C34H59Cl2N2PRu |
| Molecular Weight | 698.81 g/mol |
| Exact Mass | 698.28 |
| IUPAC Name | benzylidene(dichloro)ruthenium;1,3-dipropylimidazolidin-2-ide;tricyclohexylphosphanium |
| SMILES | C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.CCCN1[CH-]N(CCC)CC1.Cl[Ru](Cl)=Cc1ccccc1 |
| InChI | InChI=1S/C18H33P.C9H19N2.C7H6.2ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-5-10-7-8-11(9-10)6-4-2;1-7-5-3-2-4-6-7;;;/h16-18H,1-15H2;9H,3-8H2,1-2H3;1-6H;2*1H;/q;-1;;;;+2/p-1 |
| InChIKey | WRCSUBFOWZPGDR-UHFFFAOYSA-M |
| XLogP | 10.50 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 698.81 |
| LogP ≤ 5 | 10.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|