C39H62Cl2NPRuS — CID 59364894
benzylidene(dichloro)ruthenium;4,5-dimethyl-3-[(1R,4S)-2,4,6-trimethylcyclohex-2-en-1-yl]-2H-1,3-thiazol-2-ide;tricyclohexylphosphanium (PubChem CID 59364894) has the molecular formula C39H62Cl2NPRuS and a molecular weight of 779.95 g/mol. Its IUPAC name is benzylidene(dichloro)ruthenium;4,5-dimethyl-3-[(1R,4S)-2,4,6-trimethylcyclohex-2-en-1-yl]-2H-1,3-thiazol-2-ide;tricyclohexylphosphanium.
| Compound Name | benzylidene(dichloro)ruthenium;4,5-dimethyl-3-[(1R,4S)-2,4,6-trimethylcyclohex-2-en-1-yl]-2H-1,3-thiazol-2-ide;tricyclohexylphosphanium |
|---|---|
| PubChem CID | 59364894 |
| Molecular Formula | C39H62Cl2NPRuS |
| Molecular Weight | 779.95 g/mol |
| Exact Mass | 779.28 |
| IUPAC Name | benzylidene(dichloro)ruthenium;4,5-dimethyl-3-[(1R,4S)-2,4,6-trimethylcyclohex-2-en-1-yl]-2H-1,3-thiazol-2-ide;tricyclohexylphosphanium |
| SMILES | C1CCC([PH+](C2CCCCC2)C2CCCCC2)CC1.CC1=C[C@@H](C)CC(C)[C@H]1N1[CH-]SC(C)=C1C.Cl[Ru](Cl)=Cc1ccccc1 |
| InChI | InChI=1S/C18H33P.C14H22NS.C7H6.2ClH.Ru/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-9-6-10(2)14(11(3)7-9)15-8-16-13(5)12(15)4;1-7-5-3-2-4-6-7;;;/h16-18H,1-15H2;6,8-9,11,14H,7H2,1-5H3;1-6H;2*1H;/q;-1;;;;+2/p-1/t;9-,11?,14+;;;;/m.1..../s1 |
| InChIKey | YPZFYKCBNCSGNT-WNRKDZRXSA-M |
| XLogP | 13.36 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.95 |
| LogP ≤ 5 | 13.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|