C33H42Cl2N2Ru-2 — CID 21029728
benzylidene(dichloro)ruthenium;1,3-bis(2,4,6-trimethylphenyl)-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-2-ide;carbanide (PubChem CID 21029728) has the molecular formula C33H42Cl2N2Ru-2 and a molecular weight of 638.69 g/mol. Its IUPAC name is benzylidene(dichloro)ruthenium;1,3-bis(2,4,6-trimethylphenyl)-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-2-ide;carbanide.
| Compound Name | benzylidene(dichloro)ruthenium;1,3-bis(2,4,6-trimethylphenyl)-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-2-ide;carbanide |
|---|---|
| PubChem CID | 21029728 |
| Molecular Formula | C33H42Cl2N2Ru-2 |
| Molecular Weight | 638.69 g/mol |
| Exact Mass | 638.18 |
| IUPAC Name | benzylidene(dichloro)ruthenium;1,3-bis(2,4,6-trimethylphenyl)-3a,4,5,6,7,7a-hexahydro-2H-benzimidazol-2-ide;carbanide |
| SMILES | Cc1cc(C)c(N2[CH-]N(c3c(C)cc(C)cc3C)C3CCCCC32)c(C)c1.Cl[Ru](Cl)=Cc1ccccc1.[CH3-] |
| InChI | InChI=1S/C25H33N2.C7H6.CH3.2ClH.Ru/c1-16-11-18(3)24(19(4)12-16)26-15-27(23-10-8-7-9-22(23)26)25-20(5)13-17(2)14-21(25)6;1-7-5-3-2-4-6-7;;;;/h11-15,22-23H,7-10H2,1-6H3;1-6H;1H3;2*1H;/q-1;;-1;;;+2/p-2 |
| InChIKey | JINUSFIFXAIWJR-UHFFFAOYSA-L |
| XLogP | 9.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.69 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|