C41H44Cl2N2Ru-2 — CID 21029729
benzylidene(dichloro)ruthenium;carbanide;4,5-diphenyl-1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide (PubChem CID 21029729) has the molecular formula C41H44Cl2N2Ru-2 and a molecular weight of 736.79 g/mol. Its IUPAC name is benzylidene(dichloro)ruthenium;carbanide;4,5-diphenyl-1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide.
| Compound Name | benzylidene(dichloro)ruthenium;carbanide;4,5-diphenyl-1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide |
|---|---|
| PubChem CID | 21029729 |
| Molecular Formula | C41H44Cl2N2Ru-2 |
| Molecular Weight | 736.79 g/mol |
| Exact Mass | 736.19 |
| IUPAC Name | benzylidene(dichloro)ruthenium;carbanide;4,5-diphenyl-1,3-bis(2,4,6-trimethylphenyl)imidazolidin-2-ide |
| SMILES | Cc1cc(C)c(N2[CH-]N(c3c(C)cc(C)cc3C)C(c3ccccc3)C2c2ccccc2)c(C)c1.Cl[Ru](Cl)=Cc1ccccc1.[CH3-] |
| InChI | InChI=1S/C33H35N2.C7H6.CH3.2ClH.Ru/c1-22-17-24(3)30(25(4)18-22)34-21-35(31-26(5)19-23(2)20-27(31)6)33(29-15-11-8-12-16-29)32(34)28-13-9-7-10-14-28;1-7-5-3-2-4-6-7;;;;/h7-21,32-33H,1-6H3;1-6H;1H3;2*1H;/q-1;;-1;;;+2/p-2 |
| InChIKey | SARIGWSCGYOABU-UHFFFAOYSA-L |
| XLogP | 11.68 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.79 |
| LogP ≤ 5 | 11.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|