C49H56Cl2N4O4Ru-2 — CID 153475090
benzylidene(dichloro)ruthenium;bis(1,3-bis(4-methoxy-2,6-dimethylphenyl)-2H-imidazol-2-ide) (PubChem CID 153475090) has the molecular formula C49H56Cl2N4O4Ru-2 and a molecular weight of 936.99 g/mol. Its IUPAC name is benzylidene(dichloro)ruthenium;bis(1,3-bis(4-methoxy-2,6-dimethylphenyl)-2H-imidazol-2-ide).
| Compound Name | benzylidene(dichloro)ruthenium;bis(1,3-bis(4-methoxy-2,6-dimethylphenyl)-2H-imidazol-2-ide) |
|---|---|
| PubChem CID | 153475090 |
| Molecular Formula | C49H56Cl2N4O4Ru-2 |
| Molecular Weight | 936.99 g/mol |
| Exact Mass | 936.27 |
| IUPAC Name | benzylidene(dichloro)ruthenium;bis(1,3-bis(4-methoxy-2,6-dimethylphenyl)-2H-imidazol-2-ide) |
| SMILES | COc1cc(C)c(N2C=CN(c3c(C)cc(OC)cc3C)[CH-]2)c(C)c1.COc1cc(C)c(N2C=CN(c3c(C)cc(OC)cc3C)[CH-]2)c(C)c1.Cl[Ru](Cl)=Cc1ccccc1 |
| InChI | InChI=1S/2C21H25N2O2.C7H6.2ClH.Ru/c2*1-14-9-18(24-5)10-15(2)20(14)22-7-8-23(13-22)21-16(3)11-19(25-6)12-17(21)4;1-7-5-3-2-4-6-7;;;/h2*7-13H,1-6H3;1-6H;2*1H;/q2*-1;;;;+2/p-2 |
| InChIKey | TYDHAFRWSUTRCI-UHFFFAOYSA-L |
| XLogP | 12.47 |
| TPSA | 49.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 936.99 |
| LogP ≤ 5 | 12.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|