C35H48Cl2N2Ru-2 — CID 59365574
benzylidene(dichloro)ruthenium;1,3-bis[2,6-di(propan-2-yl)phenyl]imidazolidin-2-ide;carbanide (PubChem CID 59365574) has the molecular formula C35H48Cl2N2Ru-2 and a molecular weight of 668.76 g/mol. Its IUPAC name is benzylidene(dichloro)ruthenium;1,3-bis[2,6-di(propan-2-yl)phenyl]imidazolidin-2-ide;carbanide.
| Compound Name | benzylidene(dichloro)ruthenium;1,3-bis[2,6-di(propan-2-yl)phenyl]imidazolidin-2-ide;carbanide |
|---|---|
| PubChem CID | 59365574 |
| Molecular Formula | C35H48Cl2N2Ru-2 |
| Molecular Weight | 668.76 g/mol |
| Exact Mass | 668.22 |
| IUPAC Name | benzylidene(dichloro)ruthenium;1,3-bis[2,6-di(propan-2-yl)phenyl]imidazolidin-2-ide;carbanide |
| SMILES | CC(C)c1cccc(C(C)C)c1N1[CH-]N(c2c(C(C)C)cccc2C(C)C)CC1.Cl[Ru](Cl)=Cc1ccccc1.[CH3-] |
| InChI | InChI=1S/C27H39N2.C7H6.CH3.2ClH.Ru/c1-18(2)22-11-9-12-23(19(3)4)26(22)28-15-16-29(17-28)27-24(20(5)6)13-10-14-25(27)21(7)8;1-7-5-3-2-4-6-7;;;;/h9-14,17-21H,15-16H2,1-8H3;1-6H;1H3;2*1H;/q-1;;-1;;;+2/p-2 |
| InChIKey | ANAPFAIKFRTUIW-UHFFFAOYSA-L |
| XLogP | 10.84 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.76 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|