C22H28ClN2Ni-2 — CID 138962644
1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide;carbanide;chloronickel (PubChem CID 138962644) has the molecular formula C22H28ClN2Ni-2 and a molecular weight of 414.63 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide;carbanide;chloronickel.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide;carbanide;chloronickel |
|---|---|
| PubChem CID | 138962644 |
| Molecular Formula | C22H28ClN2Ni-2 |
| Molecular Weight | 414.63 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide;carbanide;chloronickel |
| SMILES | Cc1cc(C)c(N2C=CN(c3c(C)cc(C)cc3C)[CH-]2)c(C)c1.Cl[Ni].[CH3-] |
| InChI | InChI=1S/C21H25N2.CH3.ClH.Ni/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;;;/h7-13H,1-6H3;1H3;1H;/q2*-1;;+1/p-1 |
| InChIKey | WGGJSTOAZVDPAA-UHFFFAOYSA-M |
| XLogP | 6.59 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.63 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|