C21H25Cl3InN2- — CID 5256746
1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide;trichloroindigane (PubChem CID 5256746) has the molecular formula C21H25Cl3InN2- and a molecular weight of 526.62 g/mol. Its IUPAC name is 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide;trichloroindigane.
| Compound Name | 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide;trichloroindigane |
|---|---|
| PubChem CID | 5256746 |
| Molecular Formula | C21H25Cl3InN2- |
| Molecular Weight | 526.62 g/mol |
| Exact Mass | 525.01 |
| IUPAC Name | 1,3-bis(2,4,6-trimethylphenyl)-2H-imidazol-2-ide;trichloroindigane |
| SMILES | Cc1cc(C)c(N2C=CN(c3c(C)cc(C)cc3C)[CH-]2)c(C)c1.Cl[In](Cl)Cl |
| InChI | InChI=1S/C21H25N2.3ClH.In/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;;;;/h7-13H,1-6H3;3*1H;/q-1;;;;+3/p-3 |
| InChIKey | JPRCNULKPFRHNO-UHFFFAOYSA-K |
| XLogP | 7.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.62 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|