C23H30N2 — CID 134386547
2,2-dimethyl-1,3-bis(2,4,6-trimethylphenyl)imidazole (PubChem CID 134386547) has the molecular formula C23H30N2 and a molecular weight of 334.51 g/mol. Its IUPAC name is 2,2-dimethyl-1,3-bis(2,4,6-trimethylphenyl)imidazole.
| Compound Name | 2,2-dimethyl-1,3-bis(2,4,6-trimethylphenyl)imidazole |
|---|---|
| PubChem CID | 134386547 |
| Molecular Formula | C23H30N2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 2,2-dimethyl-1,3-bis(2,4,6-trimethylphenyl)imidazole |
| SMILES | Cc1cc(C)c(N2C=CN(c3c(C)cc(C)cc3C)C2(C)C)c(C)c1 |
| InChI | InChI=1S/C23H30N2/c1-15-11-17(3)21(18(4)12-15)24-9-10-25(23(24,7)8)22-19(5)13-16(2)14-20(22)6/h9-14H,1-8H3 |
| InChIKey | ZXULXNICBIFSNN-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |