C22H30N2O2Si — CID 58249843
2,2-dimethoxy-1,3-bis(2,4,6-trimethylphenyl)-1,3,2-diazasilole (PubChem CID 58249843) has the molecular formula C22H30N2O2Si and a molecular weight of 382.58 g/mol. Its IUPAC name is 2,2-dimethoxy-1,3-bis(2,4,6-trimethylphenyl)-1,3,2-diazasilole.
| Compound Name | 2,2-dimethoxy-1,3-bis(2,4,6-trimethylphenyl)-1,3,2-diazasilole |
|---|---|
| PubChem CID | 58249843 |
| Molecular Formula | C22H30N2O2Si |
| Molecular Weight | 382.58 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 2,2-dimethoxy-1,3-bis(2,4,6-trimethylphenyl)-1,3,2-diazasilole |
| SMILES | CO[Si]1(OC)N(c2c(C)cc(C)cc2C)C=CN1c1c(C)cc(C)cc1C |
| InChI | InChI=1S/C22H30N2O2Si/c1-15-11-17(3)21(18(4)12-15)23-9-10-24(27(23,25-7)26-8)22-19(5)13-16(2)14-20(22)6/h9-14H,1-8H3 |
| InChIKey | HDHRZKCULJTXBZ-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|