About CID 139244845
CID 139244845 (PubChem CID 139244845) has the molecular formula C21H24AlCl3N2
and a molecular weight of 437.78 g/mol.
Molecular Properties
| Compound Name | CID 139244845 |
| PubChem CID | 139244845 |
| Molecular Formula | C21H24AlCl3N2 |
| Molecular Weight | 437.78 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(N2[C]N(c3c(C)cc(C)cc3C)C=C2)c(C)c1.Cl[Al](Cl)Cl |
| InChI | InChI=1S/C21H24N2.Al.3ClH/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;;;;/h7-12H,1-6H3;;3*1H/q;+3;;;/p-3 |
| InChIKey | QWEQVZSNGKOESJ-UHFFFAOYSA-K |
| XLogP | 7.02 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 437.78 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 139244845 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139244845?
The IUPAC name of CID 139244845 (CID 139244845) is not available.
What is the SMILES notation for CID 139244845?
The canonical SMILES for CID 139244845 is Cc1cc(C)c(N2[C]N(c3c(C)cc(C)cc3C)C=C2)c(C)c1.Cl[Al](Cl)Cl.
What is the InChIKey of CID 139244845?
The InChIKey is QWEQVZSNGKOESJ-UHFFFAOYSA-K. The full InChI is InChI=1S/C21H24N2.Al.3ClH/c1-14-9-16(3)20(17(4)10-14)22-7-8-23(13-22)21-18(5)11-15(2)12-19(21)6;;;;/h7-12H,1-6H3;;3*1H/q;+3;;;/p-3.
What are the key properties of CID 139244845?
CID 139244845 has a molecular weight of 437.78 g/mol, XLogP of 7.02, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139244845 is sourced from PubChem (CID 139244845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).