About CID 162469513
CID 162469513 (PubChem CID 162469513) has the molecular formula C23H30N2
and a molecular weight of 334.51 g/mol.
Molecular Properties
| Compound Name | CID 162469513 |
| PubChem CID | 162469513 |
| Molecular Formula | C23H30N2 |
| Molecular Weight | 334.51 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | — |
| SMILES | Cc1cc(C)c(N2[C]N(c3c(C)cc(C)cc3C)C(C)C2C)c(C)c1 |
| InChI | InChI=1S/C23H30N2/c1-14-9-16(3)22(17(4)10-14)24-13-25(21(8)20(24)7)23-18(5)11-15(2)12-19(23)6/h9-12,20-21H,1-8H3 |
| InChIKey | QISPPGHYUGUAHI-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.51 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 162469513 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 162469513?
The IUPAC name of CID 162469513 (CID 162469513) is not available.
What is the SMILES notation for CID 162469513?
The canonical SMILES for CID 162469513 is Cc1cc(C)c(N2[C]N(c3c(C)cc(C)cc3C)C(C)C2C)c(C)c1.
What is the InChIKey of CID 162469513?
The InChIKey is QISPPGHYUGUAHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H30N2/c1-14-9-16(3)22(17(4)10-14)24-13-25(21(8)20(24)7)23-18(5)11-15(2)12-19(23)6/h9-12,20-21H,1-8H3.
What are the key properties of CID 162469513?
CID 162469513 has a molecular weight of 334.51 g/mol, XLogP of 5.64, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 162469513 is sourced from PubChem (CID 162469513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).