C21H27ClN2 — CID 173174969
4-chloro-1,3-bis(2,4,6-trimethylphenyl)imidazolidine (PubChem CID 173174969) has the molecular formula C21H27ClN2 and a molecular weight of 342.91 g/mol. Its IUPAC name is 4-chloro-1,3-bis(2,4,6-trimethylphenyl)imidazolidine.
| Compound Name | 4-chloro-1,3-bis(2,4,6-trimethylphenyl)imidazolidine |
|---|---|
| PubChem CID | 173174969 |
| Molecular Formula | C21H27ClN2 |
| Molecular Weight | 342.91 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | 4-chloro-1,3-bis(2,4,6-trimethylphenyl)imidazolidine |
| SMILES | Cc1cc(C)c(N2CC(Cl)N(c3c(C)cc(C)cc3C)C2)c(C)c1 |
| InChI | InChI=1S/C21H27ClN2/c1-13-7-15(3)20(16(4)8-13)23-11-19(22)24(12-23)21-17(5)9-14(2)10-18(21)6/h7-10,19H,11-12H2,1-6H3 |
| InChIKey | WIKKIZUEAGGQQY-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.91 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|