C16H26N2 — CID 170657864
(2R,6S)-1,2,6-trimethyl-4-(2,4,6-trimethylphenyl)piperazine (PubChem CID 170657864) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (2R,6S)-1,2,6-trimethyl-4-(2,4,6-trimethylphenyl)piperazine.
| Compound Name | (2R,6S)-1,2,6-trimethyl-4-(2,4,6-trimethylphenyl)piperazine |
|---|---|
| PubChem CID | 170657864 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | (2R,6S)-1,2,6-trimethyl-4-(2,4,6-trimethylphenyl)piperazine |
| SMILES | Cc1cc(C)c(N2C[C@@H](C)N(C)[C@@H](C)C2)c(C)c1 |
| InChI | InChI=1S/C16H26N2/c1-11-7-12(2)16(13(3)8-11)18-9-14(4)17(6)15(5)10-18/h7-8,14-15H,9-10H2,1-6H3/t14-,15+ |
| InChIKey | JJLRREFUVARHAS-GASCZTMLSA-N |
| XLogP | 3.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |